CAS 13548-69-1 appears in our catalog under these names: 2,7-Diaminofluorene dihydrochloride, 98%, 9H-Fluorene-2,7-diamine dihydrochloride, 98%, 2,7–Diaminofluorene dihydrochloride, 2,7-Diaminofluorene Dihydrochloride, >98.0%(HPLC), 9H-Fluorene-2,7-diamine dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 25g.
9H-fluorene-2,7-diamine;dihydrochloride (CAS 13548-69-1) is a chemical compound with the molecular formula C13H14Cl2N2 and a molecular weight of 269.17 g/mol. IUPAC name: 9H-fluorene-2,7-diamine;dihydrochloride. InChIKey: QJXYCUYLZDQRIN-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N2 |
|---|---|
| Molecular weight | 269.17 g/mol |
| IUPAC name | 9H-fluorene-2,7-diamine;dihydrochloride |
| InChIKey | QJXYCUYLZDQRIN-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)C3=C1C=C(C=C3)N.Cl.Cl |
Computed by PubChem (NCBI)