CAS 1909308-95-7 appears in our catalog under these names: 2-Chloro-5-methyl-N-(pyridin-3-ylmethyl)aniline hydrochloride, 95%, 2-Chloro-5-methyl-N-(pyridin-3-ylmethyl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-5-methyl-N-(pyridin-3-ylmethyl)aniline;hydrochloride (CAS 1909308-95-7) is a chemical compound with the molecular formula C13H14Cl2N2 and a molecular weight of 269.17 g/mol. IUPAC name: 2-chloro-5-methyl-N-(pyridin-3-ylmethyl)aniline;hydrochloride. InChIKey: WWVQICNOBQRWSW-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N2 |
|---|---|
| Molecular weight | 269.17 g/mol |
| IUPAC name | 2-chloro-5-methyl-N-(pyridin-3-ylmethyl)aniline;hydrochloride |
| InChIKey | WWVQICNOBQRWSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)NCC2=CN=CC=C2.Cl |
Computed by PubChem (NCBI)