CAS 135490-84-5 appears in our catalog under these names: 1–Phenyl–2–(thiophen–3–yl)ethane–1,2–dione, 1-Phenyl-2-(thiophen-3-yl)ethane-1,2-dione 97%, 1-Phenyl-2-(thiophen-3-yl)ethane-1,2-dione, 97%, 97%, 1-PHENYL-2-(3-THIENYL)ETHANE-1,2-DIONE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-phenyl-2-thiophen-3-ylethane-1,2-dione (CAS 135490-84-5) is a chemical compound with the molecular formula C12H8O2S and a molecular weight of 216.26 g/mol. IUPAC name: 1-phenyl-2-thiophen-3-ylethane-1,2-dione. InChIKey: IVQIVGIXJNMZMZ-UHFFFAOYSA-N.
| Molecular formula | C12H8O2S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 1-phenyl-2-thiophen-3-ylethane-1,2-dione |
| InChIKey | IVQIVGIXJNMZMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)C2=CSC=C2 |
Computed by PubChem (NCBI)