CAS 154629-67-1 is the registry number for Methyl 4-ethynylbenzo[b]thiophene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-ethynyl-1-benzothiophene-2-carboxylate (CAS 154629-67-1) is a chemical compound with the molecular formula C12H8O2S and a molecular weight of 216.26 g/mol. IUPAC name: methyl 4-ethynyl-1-benzothiophene-2-carboxylate. InChIKey: NKGNIUGRYFZDIL-UHFFFAOYSA-N.
| Molecular formula | C12H8O2S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | methyl 4-ethynyl-1-benzothiophene-2-carboxylate |
| InChIKey | NKGNIUGRYFZDIL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CC=C2S1)C#C |
Computed by PubChem (NCBI)