Products 1354949-76-0
CAS 1354949-76-0 is the registry number for (2-Chlorophenyl)(3,4-dimethoxyphenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-chlorophenyl)-(3,4-dimethoxyphenyl)methanamine;hydrochloride (CAS 1354949-76-0) is a chemical compound with the molecular formula C15H17Cl2NO2 and a molecular weight of 314.2 g/mol. IUPAC name: (2-chlorophenyl)-(3,4-dimethoxyphenyl)methanamine;hydrochloride. InChIKey: HIHMCXDEHQCPNR-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO2 |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | (2-chlorophenyl)-(3,4-dimethoxyphenyl)methanamine;hydrochloride |
| InChIKey | HIHMCXDEHQCPNR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C2=CC=CC=C2Cl)N)OC.Cl |
Computed by PubChem (NCBI)