CAS 1354950-57-4 appears in our catalog under these names: 1-(Pyrimidin-4-yl)piperidin-3-amine dihydrochloride, 1-(Pyrimidin-4-yl)piperidin-3-amine dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-pyrimidin-4-ylpiperidin-3-amine;dihydrochloride (CAS 1354950-57-4) is a chemical compound with the molecular formula C9H16Cl2N4 and a molecular weight of 251.15 g/mol. IUPAC name: 1-pyrimidin-4-ylpiperidin-3-amine;dihydrochloride. InChIKey: WGNCAYCUVBGFTP-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N4 |
|---|---|
| Molecular weight | 251.15 g/mol |
| IUPAC name | 1-pyrimidin-4-ylpiperidin-3-amine;dihydrochloride |
| InChIKey | WGNCAYCUVBGFTP-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)