CAS 51229-78-8 appears in our catalog under these names: Clethodim Impurity 22 Chloride, cis-1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantantane Chloride, cis-1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantantane Chloride, >95% (HPLC), cis-1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride, Chloroallyl methenamine chloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10g, 1g.
1-[(Z)-3-chloroprop-2-enyl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane chloride (CAS 51229-78-8) is a chemical compound with the molecular formula C9H16Cl2N4 and a molecular weight of 251.15 g/mol. IUPAC name: 1-[(Z)-3-chloroprop-2-enyl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane chloride. InChIKey: UKHVLWKBNNSRRR-ODZAUARKSA-M.
| Molecular formula | C9H16Cl2N4 |
|---|---|
| Molecular weight | 251.15 g/mol |
| IUPAC name | 1-[(Z)-3-chloroprop-2-enyl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane chloride |
| InChIKey | UKHVLWKBNNSRRR-ODZAUARKSA-M |
| SMILES | C1N2CN3CN1C[N+](C2)(C3)C/C=C\Cl.[Cl-] |
Computed by PubChem (NCBI)