Products 1354952-74-1

CAS 1354952-74-1 is the registry number for 2,2,2-Trifluoroethyl N-(3-phenylmethanesulfonylpropyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethyl N-(3-benzylsulfonylpropyl)carbamate (CAS 1354952-74-1) is a chemical compound with the molecular formula C13H16F3NO4S and a molecular weight of 339.33 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(3-benzylsulfonylpropyl)carbamate. InChIKey: PWUAXEBXTLRCAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16F3NO4S
Molecular weight339.33 g/mol
IUPAC name2,2,2-trifluoroethyl N-(3-benzylsulfonylpropyl)carbamate
InChIKeyPWUAXEBXTLRCAJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CS(=O)(=O)CCCNC(=O)OCC(F)(F)F

Computed by PubChem (NCBI)