CAS 1485384-14-2 appears in our catalog under these names: (2S,3S)-3-Methyl-2-(3-(trifluoromethyl)benzenesulfonamido)pentanoic acid, 95%, (2S,3S)-3-Methyl-2-(3-(trifluoromethyl)benzenesulfonamido)pentanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(2S,3S)-3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid (CAS 1485384-14-2) is a chemical compound with the molecular formula C13H16F3NO4S and a molecular weight of 339.33 g/mol. IUPAC name: (2S,3S)-3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid. InChIKey: KZQQUBYIRNCQIL-KWQFWETISA-N.
| Molecular formula | C13H16F3NO4S |
|---|---|
| Molecular weight | 339.33 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid |
| InChIKey | KZQQUBYIRNCQIL-KWQFWETISA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NS(=O)(=O)C1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)