CAS 1354953-69-7 appears in our catalog under these names: 3-Aminopiperidine-1-carboxamide, oxalic acid, 95%, 3-Aminopiperidine-1-carboxamide, oxalic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,5g, 50mg.
3-aminopiperidine-1-carboxamide;oxalic acid (CAS 1354953-69-7) is a chemical compound with the molecular formula C8H15N3O5 and a molecular weight of 233.22 g/mol. IUPAC name: 3-aminopiperidine-1-carboxamide;oxalic acid. InChIKey: RFSMOJCAEVBESW-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O5 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 3-aminopiperidine-1-carboxamide;oxalic acid |
| InChIKey | RFSMOJCAEVBESW-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)N)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)