CAS 172531-37-2 appears in our catalog under these names: 11-Azido-3,6,9-trioxaundecanoic acid, 95%, N3–PEG3–CH2COOH, N3-AEEEA*CHA, 11-Azido-3,6,9-trioxaundecanoic acid, 11-Azido-3,6,9-trioxaundecanoic Acid, >97.0%(T). Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 500mg, 1000mg, 5000mg.
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acid (CAS 172531-37-2) is a chemical compound with the molecular formula C8H15N3O5 and a molecular weight of 233.22 g/mol. IUPAC name: 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acid. InChIKey: GIXBCECBLAEYKA-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O5 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acid |
| InChIKey | GIXBCECBLAEYKA-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCC(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)