CAS 1354954-48-5 appears in our catalog under these names: 4-Chloro-3-methanesulfonylbenzene-1-sulfonyl chloride, 95%, 4-Chloro-3-methanesulfonylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-3-methylsulfonylbenzenesulfonyl chloride (CAS 1354954-48-5) is a chemical compound with the molecular formula C7H6Cl2O4S2 and a molecular weight of 289.2 g/mol. IUPAC name: 4-chloro-3-methylsulfonylbenzenesulfonyl chloride. InChIKey: VVUIJEISLYEVOO-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O4S2 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 4-chloro-3-methylsulfonylbenzenesulfonyl chloride |
| InChIKey | VVUIJEISLYEVOO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)