Products 1354954-48-5

CAS 1354954-48-5 appears in our catalog under these names: 4-Chloro-3-methanesulfonylbenzene-1-sulfonyl chloride, 95%, 4-Chloro-3-methanesulfonylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

4-chloro-3-methylsulfonylbenzenesulfonyl chloride (CAS 1354954-48-5) is a chemical compound with the molecular formula C7H6Cl2O4S2 and a molecular weight of 289.2 g/mol. IUPAC name: 4-chloro-3-methylsulfonylbenzenesulfonyl chloride. InChIKey: VVUIJEISLYEVOO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2O4S2
Molecular weight289.2 g/mol
IUPAC name4-chloro-3-methylsulfonylbenzenesulfonyl chloride
InChIKeyVVUIJEISLYEVOO-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=C(C=CC(=C1)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)