Products 90084-62-1

CAS 90084-62-1 is the registry number for 2-Chloro-5-methanesulfonylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-5-methylsulfonylbenzenesulfonyl chloride (CAS 90084-62-1) is a chemical compound with the molecular formula C7H6Cl2O4S2 and a molecular weight of 289.2 g/mol. IUPAC name: 2-chloro-5-methylsulfonylbenzenesulfonyl chloride. InChIKey: ZHCBIWRMYWDSNE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2O4S2
Molecular weight289.2 g/mol
IUPAC name2-chloro-5-methylsulfonylbenzenesulfonyl chloride
InChIKeyZHCBIWRMYWDSNE-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=C(C=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)