CAS 1354960-28-3 is the registry number for (2-Chlorophenyl)(2,5-difluorophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-chlorophenyl)-(2,5-difluorophenyl)methanamine;hydrochloride (CAS 1354960-28-3) is a chemical compound with the molecular formula C13H11Cl2F2N and a molecular weight of 290.13 g/mol. IUPAC name: (2-chlorophenyl)-(2,5-difluorophenyl)methanamine;hydrochloride. InChIKey: YMBVDMRJJPIGIE-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2F2N |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | (2-chlorophenyl)-(2,5-difluorophenyl)methanamine;hydrochloride |
| InChIKey | YMBVDMRJJPIGIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=C(C=CC(=C2)F)F)N)Cl.Cl |
Computed by PubChem (NCBI)