CAS 2243506-41-2 is the registry number for (4-Chlorophenyl)(2,3-difluorophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-chlorophenyl)-(2,3-difluorophenyl)methanamine;hydrochloride (CAS 2243506-41-2) is a chemical compound with the molecular formula C13H11Cl2F2N and a molecular weight of 290.13 g/mol. IUPAC name: (4-chlorophenyl)-(2,3-difluorophenyl)methanamine;hydrochloride. InChIKey: MEBQFBQMJGRZHE-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2F2N |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | (4-chlorophenyl)-(2,3-difluorophenyl)methanamine;hydrochloride |
| InChIKey | MEBQFBQMJGRZHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)