CAS 1354960-76-1 is the registry number for 5-{4H-Imidazo(4,5-b)pyridin-2-yl}quinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(1H-imidazo[4,5-b]pyridin-2-yl)quinoline (CAS 1354960-76-1) is a chemical compound with the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. IUPAC name: 5-(1H-imidazo[4,5-b]pyridin-2-yl)quinoline. InChIKey: MSHFVFXFSLBBKX-UHFFFAOYSA-N.
| Molecular formula | C15H10N4 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 5-(1H-imidazo[4,5-b]pyridin-2-yl)quinoline |
| InChIKey | MSHFVFXFSLBBKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=NC2=C1)C3=NC4=C(N3)C=CC=N4 |
Computed by PubChem (NCBI)