CAS 64568-34-9 is the registry number for 4,4'-(Carbonohydrazonoyl)dibenzonitrile. Offered by: Mikromol. Available pack sizes: 25mg.
4-[C-(4-cyanophenyl)carbonohydrazonoyl]benzonitrile (CAS 64568-34-9) is a chemical compound with the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. IUPAC name: 4-[C-(4-cyanophenyl)carbonohydrazonoyl]benzonitrile. InChIKey: RFAPHVOUXOSUAJ-UHFFFAOYSA-N.
| Molecular formula | C15H10N4 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 4-[C-(4-cyanophenyl)carbonohydrazonoyl]benzonitrile |
| InChIKey | RFAPHVOUXOSUAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(=NN)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)