Products 1354960-89-6
CAS 1354960-89-6 appears in our catalog under these names: 4-(Cyclopentyloxy)-3-fluoroaniline hydrochloride, 98%, 4-(Cyclopentyloxy)-3-fluoroaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-cyclopentyloxy-3-fluoroaniline;hydrochloride (CAS 1354960-89-6) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: 4-cyclopentyloxy-3-fluoroaniline;hydrochloride. InChIKey: BWVTVLJUBISIFG-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | 4-cyclopentyloxy-3-fluoroaniline;hydrochloride |
| InChIKey | BWVTVLJUBISIFG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C=C(C=C2)N)F.Cl |
Computed by PubChem (NCBI)