CAS 1354961-12-8 is the registry number for 2-Chloro-N-(trimethylthiophen-2-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-N-(3,4,5-trimethylthiophen-2-yl)acetamide (CAS 1354961-12-8) is a chemical compound with the molecular formula C9H12ClNOS and a molecular weight of 217.72 g/mol. IUPAC name: 2-chloro-N-(3,4,5-trimethylthiophen-2-yl)acetamide. InChIKey: ADWGRUBYFQEQOX-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNOS |
|---|---|
| Molecular weight | 217.72 g/mol |
| IUPAC name | 2-chloro-N-(3,4,5-trimethylthiophen-2-yl)acetamide |
| InChIKey | ADWGRUBYFQEQOX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C)NC(=O)CCl)C |
Computed by PubChem (NCBI)