CAS 35801-81-1 is the registry number for 2–Amino–1–(4–(methylthio)phenyl)ethanone hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
2-amino-1-(4-methylsulfanylphenyl)ethanone;hydrochloride (CAS 35801-81-1) is a chemical compound with the molecular formula C9H12ClNOS and a molecular weight of 217.72 g/mol. IUPAC name: 2-amino-1-(4-methylsulfanylphenyl)ethanone;hydrochloride. InChIKey: GQAWBZWKQJKFMH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNOS |
|---|---|
| Molecular weight | 217.72 g/mol |
| IUPAC name | 2-amino-1-(4-methylsulfanylphenyl)ethanone;hydrochloride |
| InChIKey | GQAWBZWKQJKFMH-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C(=O)CN.Cl |
Computed by PubChem (NCBI)