Products 1354968-23-2

CAS 1354968-23-2 is the registry number for tert-Butyl N-{2-[(2-fluorophenyl)formamido]ethyl}carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[(2-fluorobenzoyl)amino]ethyl]carbamate (CAS 1354968-23-2) is a chemical compound with the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. IUPAC name: tert-butyl N-[2-[(2-fluorobenzoyl)amino]ethyl]carbamate. InChIKey: FNSHFMYSHLPZIY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19FN2O3
Molecular weight282.31 g/mol
IUPAC nametert-butyl N-[2-[(2-fluorobenzoyl)amino]ethyl]carbamate
InChIKeyFNSHFMYSHLPZIY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCNC(=O)C1=CC=CC=C1F

Computed by PubChem (NCBI)