CAS 1932002-54-4 is the registry number for Trans-benzyl 4-(aminomethyl)-3-fluoro-4-hydroxypiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
Benzyl (3S,4R)-4-(aminomethyl)-3-fluoro-4-hydroxypiperidine-1-carboxylate (CAS 1932002-54-4) is a chemical compound with the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. IUPAC name: benzyl (3S,4R)-4-(aminomethyl)-3-fluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: YGOVYAMIHUJJDA-GXTWGEPZSA-N.
| Molecular formula | C14H19FN2O3 |
|---|---|
| Molecular weight | 282.31 g/mol |
| IUPAC name | benzyl (3S,4R)-4-(aminomethyl)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | YGOVYAMIHUJJDA-GXTWGEPZSA-N |
| SMILES | C1CN(C[C@@H]([C@@]1(CN)O)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)