Products 1355157-49-1
CAS 1355157-49-1 is the registry number for 4-Bromo-2-fluoro-1-(pentafluoroethyl)benzene. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-bromo-2-fluoro-1-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 1355157-49-1) is a chemical compound with the molecular formula C8H3BrF6 and a molecular weight of 293.00 g/mol. IUPAC name: 4-bromo-2-fluoro-1-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: LKUCYHXKELZTRV-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF6 |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | LKUCYHXKELZTRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)