CAS 1447671-80-8 is the registry number for 5-Bromo-2-fluoro-1-(1,1,2,2,2-pentafluoroethyl)-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-1-fluoro-2-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 1447671-80-8) is a chemical compound with the molecular formula C8H3BrF6 and a molecular weight of 293.00 g/mol. IUPAC name: 4-bromo-1-fluoro-2-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: NNTKOHHYNHFXFJ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF6 |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 4-bromo-1-fluoro-2-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | NNTKOHHYNHFXFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)