Products 1355247-09-4
CAS 1355247-09-4 is the registry number for 1-Bromo-3-fluoro-2-(1H-pyrazol-1-ylmethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
1-[(2-bromo-6-fluorophenyl)methyl]pyrazole (CAS 1355247-09-4) is a chemical compound with the molecular formula C10H8BrFN2 and a molecular weight of 255.09 g/mol. IUPAC name: 1-[(2-bromo-6-fluorophenyl)methyl]pyrazole. InChIKey: NJVPGHLZSCMTBV-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFN2 |
|---|---|
| Molecular weight | 255.09 g/mol |
| IUPAC name | 1-[(2-bromo-6-fluorophenyl)methyl]pyrazole |
| InChIKey | NJVPGHLZSCMTBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CN2C=CC=N2)F |
Computed by PubChem (NCBI)