Products 2270912-90-6
CAS 2270912-90-6 is the registry number for 1-[(4-Bromo-3-fluorophenyl)methyl]-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(4-bromo-3-fluorophenyl)methyl]pyrazole (CAS 2270912-90-6) is a chemical compound with the molecular formula C10H8BrFN2 and a molecular weight of 255.09 g/mol. IUPAC name: 1-[(4-bromo-3-fluorophenyl)methyl]pyrazole. InChIKey: XDYVBLPFBPCURL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFN2 |
|---|---|
| Molecular weight | 255.09 g/mol |
| IUPAC name | 1-[(4-bromo-3-fluorophenyl)methyl]pyrazole |
| InChIKey | XDYVBLPFBPCURL-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)