Products 135525-78-9
CAS 135525-78-9 is the registry number for L 697661. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(4,7-dichloro-1,3-benzoxazol-2-yl)methylamino]-5-ethyl-6-methyl-1H-pyridin-2-one (CAS 135525-78-9) is a chemical compound with the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.2 g/mol. IUPAC name: 3-[(4,7-dichloro-1,3-benzoxazol-2-yl)methylamino]-5-ethyl-6-methyl-1H-pyridin-2-one. InChIKey: WHFRDXVXYMGAJD-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2N3O2 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 3-[(4,7-dichloro-1,3-benzoxazol-2-yl)methylamino]-5-ethyl-6-methyl-1H-pyridin-2-one |
| InChIKey | WHFRDXVXYMGAJD-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC(=O)C(=C1)NCC2=NC3=C(C=CC(=C3O2)Cl)Cl)C |
Computed by PubChem (NCBI)