CAS 170449-18-0 appears in our catalog under these names: N-(3-Chlorophenyl)-6,7-dimethoxyquinazolin-4-amine hydrochloride, 95%, AG-1478 hydrochloride, AG 1478 hydrochloride, AG 1478 Hydrochloride, >95.0%(HPLC)(T), AG-1478 HCl 97%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 10mg, 50mg, 25mg, 5mg.
N-(3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride (CAS 170449-18-0) is a chemical compound with the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.2 g/mol. IUPAC name: N-(3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride. InChIKey: WDJDYIUSDDVWKB-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2N3O2 |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | N-(3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride |
| InChIKey | WDJDYIUSDDVWKB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)Cl)OC.Cl |
Computed by PubChem (NCBI)