CAS 1355251-10-3 is the registry number for Bosentan Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
4-tert-butyl-N-(4-tert-butylphenyl)sulfonylbenzenesulfonamide (CAS 1355251-10-3) is a chemical compound with the molecular formula C20H27NO4S2 and a molecular weight of 409.6 g/mol. IUPAC name: 4-tert-butyl-N-(4-tert-butylphenyl)sulfonylbenzenesulfonamide. InChIKey: UVLFQOLOOKCLKX-UHFFFAOYSA-N.
| Molecular formula | C20H27NO4S2 |
|---|---|
| Molecular weight | 409.6 g/mol |
| IUPAC name | 4-tert-butyl-N-(4-tert-butylphenyl)sulfonylbenzenesulfonamide |
| InChIKey | UVLFQOLOOKCLKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NS(=O)(=O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)