CAS 2125725-84-8 is the registry number for Tiagabine Impurity I. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-1-[3,4-dihydroxy-4,4-bis(3-methylthiophen-2-yl)butyl]piperidine-3-carboxylic acid (CAS 2125725-84-8) is a chemical compound with the molecular formula C20H27NO4S2 and a molecular weight of 409.6 g/mol. IUPAC name: (3R)-1-[3,4-dihydroxy-4,4-bis(3-methylthiophen-2-yl)butyl]piperidine-3-carboxylic acid. InChIKey: LRLPWDNQYQPWNA-AAFJCEBUSA-N.
| Molecular formula | C20H27NO4S2 |
|---|---|
| Molecular weight | 409.6 g/mol |
| IUPAC name | (3R)-1-[3,4-dihydroxy-4,4-bis(3-methylthiophen-2-yl)butyl]piperidine-3-carboxylic acid |
| InChIKey | LRLPWDNQYQPWNA-AAFJCEBUSA-N |
| SMILES | CC1=C(SC=C1)C(C2=C(C=CS2)C)(C(CCN3CCC[C@H](C3)C(=O)O)O)O |
Computed by PubChem (NCBI)