Products 135586-19-5

CAS 135586-19-5 is the registry number for 2-Bromo-3-benzyloxy-4-methoxybenzoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-4-methoxy-3-phenylmethoxybenzoate (CAS 135586-19-5) is a chemical compound with the molecular formula C16H15BrO4 and a molecular weight of 351.19 g/mol. IUPAC name: methyl 2-bromo-4-methoxy-3-phenylmethoxybenzoate. InChIKey: IMIHGELRNDVMBV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15BrO4
Molecular weight351.19 g/mol
IUPAC namemethyl 2-bromo-4-methoxy-3-phenylmethoxybenzoate
InChIKeyIMIHGELRNDVMBV-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)C(=O)OC)Br)OCC2=CC=CC=C2

Computed by PubChem (NCBI)