CAS 2570189-88-5 is the registry number for {4-Bromo-3-[(4-methoxyphenyl)methoxy]phenyl}acetic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[4-bromo-3-[(4-methoxyphenyl)methoxy]phenyl]acetic acid (CAS 2570189-88-5) is a chemical compound with the molecular formula C16H15BrO4 and a molecular weight of 351.19 g/mol. IUPAC name: 2-[4-bromo-3-[(4-methoxyphenyl)methoxy]phenyl]acetic acid. InChIKey: OSFCUIXDIZJDEK-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO4 |
|---|---|
| Molecular weight | 351.19 g/mol |
| IUPAC name | 2-[4-bromo-3-[(4-methoxyphenyl)methoxy]phenyl]acetic acid |
| InChIKey | OSFCUIXDIZJDEK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=C(C=CC(=C2)CC(=O)O)Br |
Computed by PubChem (NCBI)