CAS 135610-97-8 appears in our catalog under these names: (1R,6S,7R)-bicyclo[4.1.0]heptan-7-amine hydrochloride, 97%, 97%, rac(1R,6S,7R)-Bicyclo(4.1.0)heptan-7-amine hydrochloride. Offered by: Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1g, 0,5g, 50mg.
(1R,6S)-bicyclo[4.1.0]heptan-7-amine;hydrochloride (CAS 135610-97-8) is a chemical compound with the molecular formula C7H14ClN and a molecular weight of 147.64 g/mol. IUPAC name: (1R,6S)-bicyclo[4.1.0]heptan-7-amine;hydrochloride. InChIKey: DHFFJAHGRGPJSA-VPEOJXMDSA-N.
| Molecular formula | C7H14ClN |
|---|---|
| Molecular weight | 147.64 g/mol |
| IUPAC name | (1R,6S)-bicyclo[4.1.0]heptan-7-amine;hydrochloride |
| InChIKey | DHFFJAHGRGPJSA-VPEOJXMDSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)C2N.Cl |
Computed by PubChem (NCBI)