CAS 1356239-98-9 appears in our catalog under these names: (6-(Benzyl(methyl)amino)pyridin-3-yl)boronic acid, 98%, 98%, 6-[BENZYL(METHYL)AMINO]PYRIDINE-3-BORONIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[6-[benzyl(methyl)amino]-3-pyridinyl]boronic acid (CAS 1356239-98-9) is a chemical compound with the molecular formula C13H15BN2O2 and a molecular weight of 242.08 g/mol. IUPAC name: [6-[benzyl(methyl)amino]-3-pyridinyl]boronic acid. InChIKey: MPRLSUCCTBCVJP-UHFFFAOYSA-N.
| Molecular formula | C13H15BN2O2 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | [6-[benzyl(methyl)amino]-3-pyridinyl]boronic acid |
| InChIKey | MPRLSUCCTBCVJP-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N(C)CC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)