CAS 2225155-67-7 is the registry number for 2–Cyclopropyl–5–(4–methyl–1H–pyrazol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-cyclopropyl-5-(4-methylpyrazol-1-yl)phenyl]boronic acid (CAS 2225155-67-7) is a chemical compound with the molecular formula C13H15BN2O2 and a molecular weight of 242.08 g/mol. IUPAC name: [2-cyclopropyl-5-(4-methylpyrazol-1-yl)phenyl]boronic acid. InChIKey: QQQPFULHQFFLIR-UHFFFAOYSA-N.
| Molecular formula | C13H15BN2O2 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | [2-cyclopropyl-5-(4-methylpyrazol-1-yl)phenyl]boronic acid |
| InChIKey | QQQPFULHQFFLIR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)N2C=C(C=N2)C)C3CC3)(O)O |
Computed by PubChem (NCBI)