CAS 1356330-58-9 is the registry number for Posaconazole Impurity 77. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-2-phenylmethoxypentan-3-amine (CAS 1356330-58-9) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: (2S,3R)-2-phenylmethoxypentan-3-amine. InChIKey: CEJSJCSWGGOCFQ-CMPLNLGQSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | (2S,3R)-2-phenylmethoxypentan-3-amine |
| InChIKey | CEJSJCSWGGOCFQ-CMPLNLGQSA-N |
| SMILES | CC[C@H]([C@H](C)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)