CAS 1356330-68-1 appears in our catalog under these names: Posaconazole Impurity 76, Posaconazole Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-2-phenylmethoxypentan-3-amine (CAS 1356330-68-1) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: (2S,3S)-2-phenylmethoxypentan-3-amine. InChIKey: CEJSJCSWGGOCFQ-JQWIXIFHSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | (2S,3S)-2-phenylmethoxypentan-3-amine |
| InChIKey | CEJSJCSWGGOCFQ-JQWIXIFHSA-N |
| SMILES | CC[C@@H]([C@H](C)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)