CAS 1356451-99-4 is the registry number for 2-(2-(4-Chloro-2,6-dimethylphenoxy)-1-methylethyl)-1H-isoindole-1,3(2H)-dione. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
2-[1-(4-chloro-2,6-dimethylphenoxy)propan-2-yl]isoindole-1,3-dione (CAS 1356451-99-4) is a chemical compound with the molecular formula C19H18ClNO3 and a molecular weight of 343.8 g/mol. IUPAC name: 2-[1-(4-chloro-2,6-dimethylphenoxy)propan-2-yl]isoindole-1,3-dione. InChIKey: LCZMBPQHKZCZBG-UHFFFAOYSA-N.
| Molecular formula | C19H18ClNO3 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 2-[1-(4-chloro-2,6-dimethylphenoxy)propan-2-yl]isoindole-1,3-dione |
| InChIKey | LCZMBPQHKZCZBG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC(C)N2C(=O)C3=CC=CC=C3C2=O)C)Cl |
Computed by PubChem (NCBI)