CAS 934389-88-5 appears in our catalog under these names: LY 294002 hydrochloride, LY 294002 Hydrochloride, LY-294002 hydrochloride/ 99.95% (existing batch purity), LY294002 HCl 97%, 2-(morpholin-4-yl)-8-phenyl-4H-chromen-4-one hydrochloride, 97%, 97%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 250mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg.
2-morpholin-4-yl-8-phenylchromen-4-one;hydrochloride (CAS 934389-88-5) is a chemical compound with the molecular formula C19H18ClNO3 and a molecular weight of 343.8 g/mol. IUPAC name: 2-morpholin-4-yl-8-phenylchromen-4-one;hydrochloride. InChIKey: OQZQSRICUOWBLW-UHFFFAOYSA-N.
| Molecular formula | C19H18ClNO3 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 2-morpholin-4-yl-8-phenylchromen-4-one;hydrochloride |
| InChIKey | OQZQSRICUOWBLW-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=O)C3=C(O2)C(=CC=C3)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)