CAS 1356537-01-3 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)thiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-thiazole-5-carboxylic acid (CAS 1356537-01-3) is a chemical compound with the molecular formula C19H14N2O4S and a molecular weight of 366.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-thiazole-5-carboxylic acid. InChIKey: IDZRRGQFZAKTDA-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-thiazole-5-carboxylic acid |
| InChIKey | IDZRRGQFZAKTDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=NC=C(S4)C(=O)O |
Computed by PubChem (NCBI)