Products 313482-91-6
CAS 313482-91-6 appears in our catalog under these names: CZL80, CZL80, 98.31%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 10mM/1mL, 100 mg.
3-[[3-(thiophene-2-carbonylamino)benzoyl]amino]benzoic acid (CAS 313482-91-6) is a chemical compound with the molecular formula C19H14N2O4S and a molecular weight of 366.4 g/mol. IUPAC name: 3-[[3-(thiophene-2-carbonylamino)benzoyl]amino]benzoic acid. InChIKey: XROMSNNVKZCXLL-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 3-[[3-(thiophene-2-carbonylamino)benzoyl]amino]benzoic acid |
| InChIKey | XROMSNNVKZCXLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=CS2)C(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)