Products 1356542-51-2
CAS 1356542-51-2 is the registry number for 1-{5-Chloro-2H,3H-pyrrolo[2,3-b]pyridin-1-yl}ethanone, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(5-chloro-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)ethanone (CAS 1356542-51-2) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 1-(5-chloro-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)ethanone. InChIKey: AXJIOEQSFJVJAF-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 1-(5-chloro-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)ethanone |
| InChIKey | AXJIOEQSFJVJAF-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1N=CC(=C2)Cl |
Computed by PubChem (NCBI)