CAS 1356832-52-4 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 1g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)pyridine (CAS 1356832-52-4) is a chemical compound with the molecular formula C12H15BF3NO3 and a molecular weight of 289.06 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)pyridine. InChIKey: OVOJKQWHLYTQCF-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO3 |
|---|---|
| Molecular weight | 289.06 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)pyridine |
| InChIKey | OVOJKQWHLYTQCF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)OC(F)(F)F |
Computed by PubChem (NCBI)