Products 2377607-97-9

CAS 2377607-97-9 is the registry number for [2-(tert-Butylcarbamoyl)-3-(trifluoromethyl)phenyl]boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[2-(tert-butylcarbamoyl)-3-(trifluoromethyl)phenyl]boronic acid (CAS 2377607-97-9) is a chemical compound with the molecular formula C12H15BF3NO3 and a molecular weight of 289.06 g/mol. IUPAC name: [2-(tert-butylcarbamoyl)-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: QQDOPPAVVMVBNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BF3NO3
Molecular weight289.06 g/mol
IUPAC name[2-(tert-butylcarbamoyl)-3-(trifluoromethyl)phenyl]boronic acid
InChIKeyQQDOPPAVVMVBNZ-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)C(F)(F)F)C(=O)NC(C)(C)C)(O)O

Computed by PubChem (NCBI)