CAS 1356932-13-2 appears in our catalog under these names: Enalapril Impurity 2 Maleate(Enalapril EP Impurity A Maleate), (R,S,S)-Enalapril Maleate, Enalapril maleate impurity A. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg, 1mg.
(Z)-but-2-enedioic acid;(2S)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 1356932-13-2) is a chemical compound with the molecular formula C24H32N2O9 and a molecular weight of 492.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;(2S)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: OYFJQPXVCSSHAI-BMSLDGIRSA-N.
| Molecular formula | C24H32N2O9 |
|---|---|
| Molecular weight | 492.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;(2S)-1-[(2S)-2-[[(2R)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | OYFJQPXVCSSHAI-BMSLDGIRSA-N |
| SMILES | CCOC(=O)[C@@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)