CAS 1356963-19-3 is the registry number for 3–(2,5–dichloropyrimidin–4–yl)–1–methyl–1H–indole. Offered by: GLPBio. Available pack sizes: 100mg.
3-(2,5-dichloropyrimidin-4-yl)-1-methylindole (CAS 1356963-19-3) is a chemical compound with the molecular formula C13H9Cl2N3 and a molecular weight of 278.13 g/mol. IUPAC name: 3-(2,5-dichloropyrimidin-4-yl)-1-methylindole. InChIKey: MBYZPCLOMQCIEV-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 3-(2,5-dichloropyrimidin-4-yl)-1-methylindole |
| InChIKey | MBYZPCLOMQCIEV-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3Cl)Cl |
Computed by PubChem (NCBI)