CAS 303099-03-8 is the registry number for 4–(5,7–Dichloro–1H–benzo(d)imidazol–2–yl)aniline. Offered by: GLPBio. Available pack sizes: 100mg.
4-(4,6-dichloro-1H-benzimidazol-2-yl)aniline (CAS 303099-03-8) is a chemical compound with the molecular formula C13H9Cl2N3 and a molecular weight of 278.13 g/mol. IUPAC name: 4-(4,6-dichloro-1H-benzimidazol-2-yl)aniline. InChIKey: MDMZZYHAHPZWFT-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 4-(4,6-dichloro-1H-benzimidazol-2-yl)aniline |
| InChIKey | MDMZZYHAHPZWFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3Cl)Cl)N |
Computed by PubChem (NCBI)