Products 1356992-90-9
CAS 1356992-90-9 appears in our catalog under these names: N-Acetyl glufosinate-d3, D3-Glufosinate-N-acetyl, 100 µg/ml in Water, ISO 17034 CRM, N-acetyl-D3-glufosinate. Offered by: MedChemExpress, HPC Standards, Sigma-Aldrich. Available pack sizes: 5 mg, 1 mg, 1ml, 5MG.
4-[hydroxy(methyl)phosphoryl]-2-[(2,2,2-trideuterioacetyl)amino]butanoic acid (CAS 1356992-90-9) is a chemical compound with the molecular formula C7H14NO5P and a molecular weight of 226.18 g/mol. IUPAC name: 4-[hydroxy(methyl)phosphoryl]-2-[(2,2,2-trideuterioacetyl)amino]butanoic acid. InChIKey: VZVQOWUYAAWBCP-FIBGUPNXSA-N.
| Molecular formula | C7H14NO5P |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 4-[hydroxy(methyl)phosphoryl]-2-[(2,2,2-trideuterioacetyl)amino]butanoic acid |
| InChIKey | VZVQOWUYAAWBCP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC(CCP(=O)(C)O)C(=O)O |
Computed by PubChem (NCBI)