CAS 1357362-02-7 appears in our catalog under these names: Vafidemstat, 97%, Vafidemstat/ 99.53% (existing batch purity), Vafidemstat, Vafidemstat (ORY–2001), 5-((((1R,2S)-2-(4-(Benzyloxy)phenyl)cyclopropyl)amino)methyl)-1,3,4-oxadiazol-2-amine. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg, 10mM/1mL.
5-[[[(1R,2S)-2-(4-phenylmethoxyphenyl)cyclopropyl]amino]methyl]-1,3,4-oxadiazol-2-amine (CAS 1357362-02-7) is a chemical compound with the molecular formula C19H20N4O2 and a molecular weight of 336.4 g/mol. IUPAC name: 5-[[[(1R,2S)-2-(4-phenylmethoxyphenyl)cyclopropyl]amino]methyl]-1,3,4-oxadiazol-2-amine. InChIKey: XBBRLCXCBCZIOI-DLBZAZTESA-N.
| Molecular formula | C19H20N4O2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 5-[[[(1R,2S)-2-(4-phenylmethoxyphenyl)cyclopropyl]amino]methyl]-1,3,4-oxadiazol-2-amine |
| InChIKey | XBBRLCXCBCZIOI-DLBZAZTESA-N |
| SMILES | C1[C@H]([C@@H]1NCC2=NN=C(O2)N)C3=CC=C(C=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)