CAS 1375163-30-6 is the registry number for MC3629. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-methyl-1-phenylpyrazole-4-carboxamide (CAS 1375163-30-6) is a chemical compound with the molecular formula C19H20N4O2 and a molecular weight of 336.4 g/mol. IUPAC name: N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-methyl-1-phenylpyrazole-4-carboxamide. InChIKey: LLWAEAQGDHLXKV-UHFFFAOYSA-N.
| Molecular formula | C19H20N4O2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-methyl-1-phenylpyrazole-4-carboxamide |
| InChIKey | LLWAEAQGDHLXKV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CNC(=O)C2=C(N(N=C2)C3=CC=CC=C3)C)C |
Computed by PubChem (NCBI)